C22H42N3O5Si — CID 59804598
CID 59804598 (PubChem CID 59804598) has the molecular formula C22H42N3O5Si and a molecular weight of 456.68 g/mol.
| Compound Name | CID 59804598 |
|---|---|
| PubChem CID | 59804598 |
| Molecular Formula | C22H42N3O5Si |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | — |
| SMILES | CCO[Si](C)CCCN(C)C(=O)NC1CC(C)(C)CC(C)(CNC(=O)OCC2CO2)C1 |
| InChI | InChI=1S/C22H42N3O5Si/c1-7-30-31(6)10-8-9-25(5)19(26)24-17-11-21(2,3)15-22(4,12-17)16-23-20(27)29-14-18-13-28-18/h17-18H,7-16H2,1-6H3,(H,23,27)(H,24,26) |
| InChIKey | FWSLGLCDTHLSSC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|