C20H37N3O5Si — CID 59804572
CID 59804572 (PubChem CID 59804572) has the molecular formula C20H37N3O5Si and a molecular weight of 427.62 g/mol.
| Compound Name | CID 59804572 |
|---|---|
| PubChem CID | 59804572 |
| Molecular Formula | C20H37N3O5Si |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | — |
| SMILES | CO[Si]CCCN(C)C(=O)NCC1(C)CC(NC(=O)OCC2CO2)CC(C)(C)C1 |
| InChI | InChI=1S/C20H37N3O5Si/c1-19(2)9-15(22-18(25)28-12-16-11-27-16)10-20(3,13-19)14-21-17(24)23(4)7-6-8-29-26-5/h15-16H,6-14H2,1-5H3,(H,21,24)(H,22,25) |
| InChIKey | QOXDWPDXWSRFSQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|