About nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate
nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate (PubChem CID 121360180) has the molecular formula C39H79NO4
and a molecular weight of 626.06 g/mol. Its IUPAC name is nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate.
Molecular Properties
| Compound Name | nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate |
| PubChem CID | 121360180 |
| Molecular Formula | C39H79NO4 |
| Molecular Weight | 626.06 g/mol |
| Exact Mass | 625.60 |
| IUPAC Name | nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate |
| SMILES | CCCCCCCCCC(CCCCCCCCC)OONC(=O)OC(CCCCCCCCC)CCCCCCCCC |
| InChI | InChI=1S/C39H79NO4/c1-5-9-13-17-21-25-29-33-37(34-30-26-22-18-14-10-6-2)42-39(41)40-44-43-38(35-31-27-23-19-15-11-7-3)36-32-28-24-20-16-12-8-4/h37-38H,5-36H2,1-4H3,(H,40,41) |
| InChIKey | DRYPUEOIESBCJE-UHFFFAOYSA-N |
| XLogP | 13.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 626.06 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate?
The IUPAC name of nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate (CID 121360180) is nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate.
What is the SMILES notation for nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate?
The canonical SMILES for nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate is CCCCCCCCCC(CCCCCCCCC)OONC(=O)OC(CCCCCCCCC)CCCCCCCCC.
What is the InChIKey of nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate?
The InChIKey is DRYPUEOIESBCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H79NO4/c1-5-9-13-17-21-25-29-33-37(34-30-26-22-18-14-10-6-2)42-39(41)40-44-43-38(35-31-27-23-19-15-11-7-3)36-32-28-24-20-16-12-8-4/h37-38H,5-36H2,1-4H3,(H,40,41).
What are the key properties of nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate?
nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate has a molecular weight of 626.06 g/mol, XLogP of 13.88, 36 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nonadecan-10-yl N-nonadecan-10-ylperoxycarbamate is sourced from PubChem (CID 121360180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).