About pentadecan-6-yl N-propan-2-ylcarbamate
pentadecan-6-yl N-propan-2-ylcarbamate (PubChem CID 87949902) has the molecular formula C19H39NO2
and a molecular weight of 313.53 g/mol. Its IUPAC name is pentadecan-6-yl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | pentadecan-6-yl N-propan-2-ylcarbamate |
| PubChem CID | 87949902 |
| Molecular Formula | C19H39NO2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.30 |
| IUPAC Name | pentadecan-6-yl N-propan-2-ylcarbamate |
| SMILES | CCCCCCCCCC(CCCCC)OC(=O)NC(C)C |
| InChI | InChI=1S/C19H39NO2/c1-5-7-9-10-11-12-14-16-18(15-13-8-6-2)22-19(21)20-17(3)4/h17-18H,5-16H2,1-4H3,(H,20,21) |
| InChIKey | OAFQOKVIBJXWPI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentadecan-6-yl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadecan-6-yl N-propan-2-ylcarbamate?
The IUPAC name of pentadecan-6-yl N-propan-2-ylcarbamate (CID 87949902) is pentadecan-6-yl N-propan-2-ylcarbamate.
What is the SMILES notation for pentadecan-6-yl N-propan-2-ylcarbamate?
The canonical SMILES for pentadecan-6-yl N-propan-2-ylcarbamate is CCCCCCCCCC(CCCCC)OC(=O)NC(C)C.
What is the InChIKey of pentadecan-6-yl N-propan-2-ylcarbamate?
The InChIKey is OAFQOKVIBJXWPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NO2/c1-5-7-9-10-11-12-14-16-18(15-13-8-6-2)22-19(21)20-17(3)4/h17-18H,5-16H2,1-4H3,(H,20,21).
What are the key properties of pentadecan-6-yl N-propan-2-ylcarbamate?
pentadecan-6-yl N-propan-2-ylcarbamate has a molecular weight of 313.53 g/mol, XLogP of 6.21, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentadecan-6-yl N-propan-2-ylcarbamate is sourced from PubChem (CID 87949902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).