C35H67N3O7Si — CID 140673230
[1-[(2,2-dimethyl-4-triethoxysilylbutyl)amino]-1-oxoundecan-4-yl] N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate (PubChem CID 140673230) has the molecular formula C35H67N3O7Si and a molecular weight of 670.02 g/mol. Its IUPAC name is [1-[(2,2-dimethyl-4-triethoxysilylbutyl)amino]-1-oxoundecan-4-yl] N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate.
| Compound Name | [1-[(2,2-dimethyl-4-triethoxysilylbutyl)amino]-1-oxoundecan-4-yl] N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 140673230 |
| Molecular Formula | C35H67N3O7Si |
| Molecular Weight | 670.02 g/mol |
| Exact Mass | 669.47 |
| IUPAC Name | [1-[(2,2-dimethyl-4-triethoxysilylbutyl)amino]-1-oxoundecan-4-yl] N-[(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl]carbamate |
| SMILES | CCCCCCCC(CCC(=O)NCC(C)(C)CC[Si](OCC)(OCC)OCC)OC(=O)NCC1(C)CC(N=C=O)CC(C)(C)C1 |
| InChI | InChI=1S/C35H67N3O7Si/c1-10-14-15-16-17-18-30(45-32(41)37-27-35(9)24-29(38-28-39)23-34(7,8)25-35)19-20-31(40)36-26-33(5,6)21-22-46(42-11-2,43-12-3)44-13-4/h29-30H,10-27H2,1-9H3,(H,36,40)(H,37,41) |
| InChIKey | DZKAGGIAUTVJCS-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.02 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|