C21H45NO5Si — CID 90015314
N-(2,2-dimethyl-4-trimethoxysilylbutyl)-4-hydroxydodecanamide (PubChem CID 90015314) has the molecular formula C21H45NO5Si and a molecular weight of 419.68 g/mol. Its IUPAC name is N-(2,2-dimethyl-4-trimethoxysilylbutyl)-4-hydroxydodecanamide.
| Compound Name | N-(2,2-dimethyl-4-trimethoxysilylbutyl)-4-hydroxydodecanamide |
|---|---|
| PubChem CID | 90015314 |
| Molecular Formula | C21H45NO5Si |
| Molecular Weight | 419.68 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | N-(2,2-dimethyl-4-trimethoxysilylbutyl)-4-hydroxydodecanamide |
| SMILES | CCCCCCCCC(O)CCC(=O)NCC(C)(C)CC[Si](OC)(OC)OC |
| InChI | InChI=1S/C21H45NO5Si/c1-7-8-9-10-11-12-13-19(23)14-15-20(24)22-18-21(2,3)16-17-28(25-4,26-5)27-6/h19,23H,7-18H2,1-6H3,(H,22,24) |
| InChIKey | LWTHJWHPJJIPGI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.68 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|