C14H28BrNO — CID 106145537
N-(5-bromo-2,2-dimethylpentyl)heptanamide (PubChem CID 106145537) has the molecular formula C14H28BrNO and a molecular weight of 306.29 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)heptanamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)heptanamide |
|---|---|
| PubChem CID | 106145537 |
| Molecular Formula | C14H28BrNO |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)heptanamide |
| SMILES | CCCCCCC(=O)NCC(C)(C)CCCBr |
| InChI | InChI=1S/C14H28BrNO/c1-4-5-6-7-9-13(17)16-12-14(2,3)10-8-11-15/h4-12H2,1-3H3,(H,16,17) |
| InChIKey | MQUZABZBMXSFQE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|