C15H30BrNO — CID 106145033
N-(5-bromo-2,2-dimethylpentyl)-2-ethylhexanamide (PubChem CID 106145033) has the molecular formula C15H30BrNO and a molecular weight of 320.32 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-2-ethylhexanamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-2-ethylhexanamide |
|---|---|
| PubChem CID | 106145033 |
| Molecular Formula | C15H30BrNO |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-2-ethylhexanamide |
| SMILES | CCCCC(CC)C(=O)NCC(C)(C)CCCBr |
| InChI | InChI=1S/C15H30BrNO/c1-5-7-9-13(6-2)14(18)17-12-15(3,4)10-8-11-16/h13H,5-12H2,1-4H3,(H,17,18) |
| InChIKey | PPXHFUCAAQJEGI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|