C18H34BrNO — CID 106145391
N-(5-bromo-2,2-dimethylpentyl)-4-butylcyclohexane-1-carboxamide (PubChem CID 106145391) has the molecular formula C18H34BrNO and a molecular weight of 360.38 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-4-butylcyclohexane-1-carboxamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-4-butylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106145391 |
| Molecular Formula | C18H34BrNO |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-4-butylcyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)NCC(C)(C)CCCBr)CC1 |
| InChI | InChI=1S/C18H34BrNO/c1-4-5-7-15-8-10-16(11-9-15)17(21)20-14-18(2,3)12-6-13-19/h15-16H,4-14H2,1-3H3,(H,20,21) |
| InChIKey | WDXDWGQAVPIDBA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|