C15H25BrF3NO — CID 106145635
N-(5-bromo-2,2-dimethylpentyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 106145635) has the molecular formula C15H25BrF3NO and a molecular weight of 372.27 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106145635 |
| Molecular Formula | C15H25BrF3NO |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CC(C)(CCCBr)CNC(=O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H25BrF3NO/c1-14(2,7-4-8-16)10-20-13(21)11-5-3-6-12(9-11)15(17,18)19/h11-12H,3-10H2,1-2H3,(H,20,21) |
| InChIKey | XNSLOLDMZKFPAW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|