C14H23BrF3NO — CID 106355181
N-(1-bromo-4-methylpentan-3-yl)-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 106355181) has the molecular formula C14H23BrF3NO and a molecular weight of 358.24 g/mol. Its IUPAC name is N-(1-bromo-4-methylpentan-3-yl)-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(1-bromo-4-methylpentan-3-yl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106355181 |
| Molecular Formula | C14H23BrF3NO |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-(1-bromo-4-methylpentan-3-yl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CC(C)C(CCBr)NC(=O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H23BrF3NO/c1-9(2)12(6-7-15)19-13(20)10-4-3-5-11(8-10)14(16,17)18/h9-12H,3-8H2,1-2H3,(H,19,20) |
| InChIKey | XHKDFEJQMXJMGG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|