C12H22ClF3N2O — CID 119507185
N-[2-(ethylamino)ethyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119507185) has the molecular formula C12H22ClF3N2O and a molecular weight of 302.77 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119507185 |
| Molecular Formula | C12H22ClF3N2O |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)C1CCCC(C(F)(F)F)C1.Cl |
| InChI | InChI=1S/C12H21F3N2O.ClH/c1-2-16-6-7-17-11(18)9-4-3-5-10(8-9)12(13,14)15;/h9-10,16H,2-8H2,1H3,(H,17,18);1H |
| InChIKey | CYSJNCQZEYMBMC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|