C12H19ClF3NO — CID 106845327
N-(4-chlorobutyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 106845327) has the molecular formula C12H19ClF3NO and a molecular weight of 285.74 g/mol. Its IUPAC name is N-(4-chlorobutyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(4-chlorobutyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106845327 |
| Molecular Formula | C12H19ClF3NO |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-(4-chlorobutyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCCCCCl)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H19ClF3NO/c13-6-1-2-7-17-11(18)9-4-3-5-10(8-9)12(14,15)16/h9-10H,1-8H2,(H,17,18) |
| InChIKey | GEORISHETOIJDX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|