C14H24F3NO2 — CID 111461165
N-(3-hydroxy-4-methylpentyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 111461165) has the molecular formula C14H24F3NO2 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-(3-hydroxy-4-methylpentyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-hydroxy-4-methylpentyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 111461165 |
| Molecular Formula | C14H24F3NO2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-(3-hydroxy-4-methylpentyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CC(C)C(O)CCNC(=O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H24F3NO2/c1-9(2)12(19)6-7-18-13(20)10-4-3-5-11(8-10)14(15,16)17/h9-12,19H,3-8H2,1-2H3,(H,18,20) |
| InChIKey | YSGMUHSOWWZJAA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |