C13H21BrF3NO2 — CID 106244823
N-(3-bromo-4-methoxybutyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 106244823) has the molecular formula C13H21BrF3NO2 and a molecular weight of 360.21 g/mol. Its IUPAC name is N-(3-bromo-4-methoxybutyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-bromo-4-methoxybutyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106244823 |
| Molecular Formula | C13H21BrF3NO2 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N-(3-bromo-4-methoxybutyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | COCC(Br)CCNC(=O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H21BrF3NO2/c1-20-8-11(14)5-6-18-12(19)9-3-2-4-10(7-9)13(15,16)17/h9-11H,2-8H2,1H3,(H,18,19) |
| InChIKey | APXPYAWVOREXTF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|