C9H12BrF6NO2 — CID 106245359
N-(3-bromo-4-methoxybutyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 106245359) has the molecular formula C9H12BrF6NO2 and a molecular weight of 360.09 g/mol. Its IUPAC name is N-(3-bromo-4-methoxybutyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-(3-bromo-4-methoxybutyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 106245359 |
| Molecular Formula | C9H12BrF6NO2 |
| Molecular Weight | 360.09 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | N-(3-bromo-4-methoxybutyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | COCC(Br)CCNC(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12BrF6NO2/c1-19-4-5(10)2-3-17-7(18)6(8(11,12)13)9(14,15)16/h5-6H,2-4H2,1H3,(H,17,18) |
| InChIKey | XEKZVKSASGTBSM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|