C10H20BrNO4 — CID 106245181
N-(3-bromo-4-methoxybutyl)-2-(2-methoxyethoxy)acetamide (PubChem CID 106245181) has the molecular formula C10H20BrNO4 and a molecular weight of 298.18 g/mol. Its IUPAC name is N-(3-bromo-4-methoxybutyl)-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-(3-bromo-4-methoxybutyl)-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 106245181 |
| Molecular Formula | C10H20BrNO4 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-(3-bromo-4-methoxybutyl)-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NCCC(Br)COC |
| InChI | InChI=1S/C10H20BrNO4/c1-14-5-6-16-8-10(13)12-4-3-9(11)7-15-2/h9H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | FDGZLKZPZGNKJZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|