C9H16Cl2N2O4 — CID 108574831
2,2-dichloro-N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]acetamide (PubChem CID 108574831) has the molecular formula C9H16Cl2N2O4 and a molecular weight of 287.14 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]acetamide.
| Compound Name | 2,2-dichloro-N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 108574831 |
| Molecular Formula | C9H16Cl2N2O4 |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2,2-dichloro-N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]acetamide |
| SMILES | COCCOCC(=O)NCCNC(=O)C(Cl)Cl |
| InChI | InChI=1S/C9H16Cl2N2O4/c1-16-4-5-17-6-7(14)12-2-3-13-9(15)8(10)11/h8H,2-6H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | DKOSCILXARBJLS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|