C8H10ClF6NO2 — CID 103311002
N-(2-chloro-3-methoxypropyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 103311002) has the molecular formula C8H10ClF6NO2 and a molecular weight of 301.61 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 103311002 |
| Molecular Formula | C8H10ClF6NO2 |
| Molecular Weight | 301.61 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | COCC(Cl)CNC(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10ClF6NO2/c1-18-3-4(9)2-16-6(17)5(7(10,11)12)8(13,14)15/h4-5H,2-3H2,1H3,(H,16,17) |
| InChIKey | UXQOUHQDNZYDQH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.61 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|