C9H12BrF6NO — CID 103311077
N-(2-bromo-3-methylbutyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 103311077) has the molecular formula C9H12BrF6NO and a molecular weight of 344.09 g/mol. Its IUPAC name is N-(2-bromo-3-methylbutyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-(2-bromo-3-methylbutyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 103311077 |
| Molecular Formula | C9H12BrF6NO |
| Molecular Weight | 344.09 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | N-(2-bromo-3-methylbutyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | CC(C)C(Br)CNC(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12BrF6NO/c1-4(2)5(10)3-17-7(18)6(8(11,12)13)9(14,15)16/h4-6H,3H2,1-2H3,(H,17,18) |
| InChIKey | HLCQONGTIYRTQI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.09 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|