About N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide
N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 103311024) has the molecular formula C8H10BrF6NO
and a molecular weight of 330.07 g/mol. Its IUPAC name is N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
Molecular Properties
| Compound Name | N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| PubChem CID | 103311024 |
| Molecular Formula | C8H10BrF6NO |
| Molecular Weight | 330.07 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | CCC(CBr)NC(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10BrF6NO/c1-2-4(3-9)16-6(17)5(7(10,11)12)8(13,14)15/h4-5H,2-3H2,1H3,(H,16,17) |
| InChIKey | OVDAHLRGZJTZJC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.07 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide?
The IUPAC name of N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (CID 103311024) is N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
What is the SMILES notation for N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide?
The canonical SMILES for N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide is CCC(CBr)NC(=O)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide?
The InChIKey is OVDAHLRGZJTZJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrF6NO/c1-2-4(3-9)16-6(17)5(7(10,11)12)8(13,14)15/h4-5H,2-3H2,1H3,(H,16,17).
What are the key properties of N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide?
N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide has a molecular weight of 330.07 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-bromobutan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide is sourced from PubChem (CID 103311024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).