C8H12BrF2NO2 — CID 103516372
N-(6-bromo-5-oxohexan-3-yl)-2,2-difluoroacetamide (PubChem CID 103516372) has the molecular formula C8H12BrF2NO2 and a molecular weight of 272.09 g/mol. Its IUPAC name is N-(6-bromo-5-oxohexan-3-yl)-2,2-difluoroacetamide.
| Compound Name | N-(6-bromo-5-oxohexan-3-yl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103516372 |
| Molecular Formula | C8H12BrF2NO2 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | N-(6-bromo-5-oxohexan-3-yl)-2,2-difluoroacetamide |
| SMILES | CCC(CC(=O)CBr)NC(=O)C(F)F |
| InChI | InChI=1S/C8H12BrF2NO2/c1-2-5(3-6(13)4-9)12-8(14)7(10)11/h5,7H,2-4H2,1H3,(H,12,14) |
| InChIKey | HWWOPDCREBFXSO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|