C9H18N2O3S2 — CID 104519401
N-(1-amino-1-sulfanylidenepentan-3-yl)-2-methylsulfonylpropanamide (PubChem CID 104519401) has the molecular formula C9H18N2O3S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenepentan-3-yl)-2-methylsulfonylpropanamide.
| Compound Name | N-(1-amino-1-sulfanylidenepentan-3-yl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 104519401 |
| Molecular Formula | C9H18N2O3S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-(1-amino-1-sulfanylidenepentan-3-yl)-2-methylsulfonylpropanamide |
| SMILES | CCC(CC(N)=S)NC(=O)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C9H18N2O3S2/c1-4-7(5-8(10)15)11-9(12)6(2)16(3,13)14/h6-7H,4-5H2,1-3H3,(H2,10,15)(H,11,12) |
| InChIKey | FICZWJLZURMUJQ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|