C7H13NO5S — CID 115731150
2-(2-methylsulfonylpropanoylamino)propanoic acid (PubChem CID 115731150) has the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. Its IUPAC name is 2-(2-methylsulfonylpropanoylamino)propanoic acid.
| Compound Name | 2-(2-methylsulfonylpropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 115731150 |
| Molecular Formula | C7H13NO5S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-(2-methylsulfonylpropanoylamino)propanoic acid |
| SMILES | CC(NC(=O)C(C)S(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C7H13NO5S/c1-4(7(10)11)8-6(9)5(2)14(3,12)13/h4-5H,1-3H3,(H,8,9)(H,10,11) |
| InChIKey | HEXSEDHSEQILKG-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |