C9H17NO5S — CID 103804185
(2S)-3-methyl-2-(2-methylsulfonylpropanoylamino)butanoic acid (PubChem CID 103804185) has the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. Its IUPAC name is (2S)-3-methyl-2-(2-methylsulfonylpropanoylamino)butanoic acid.
| Compound Name | (2S)-3-methyl-2-(2-methylsulfonylpropanoylamino)butanoic acid |
|---|---|
| PubChem CID | 103804185 |
| Molecular Formula | C9H17NO5S |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (2S)-3-methyl-2-(2-methylsulfonylpropanoylamino)butanoic acid |
| SMILES | CC(C)[C@H](NC(=O)C(C)S(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C9H17NO5S/c1-5(2)7(9(12)13)10-8(11)6(3)16(4,14)15/h5-7H,1-4H3,(H,10,11)(H,12,13)/t6?,7-/m0/s1 |
| InChIKey | UPVATPKTMZRSKV-MLWJPKLSSA-N |
| XLogP | -0.36 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |