C8H17N3OS — CID 62651279
1-(1-amino-1-sulfanylidenepentan-3-yl)-3-ethylurea (PubChem CID 62651279) has the molecular formula C8H17N3OS and a molecular weight of 203.31 g/mol. Its IUPAC name is 1-(1-amino-1-sulfanylidenepentan-3-yl)-3-ethylurea.
| Compound Name | 1-(1-amino-1-sulfanylidenepentan-3-yl)-3-ethylurea |
|---|---|
| PubChem CID | 62651279 |
| Molecular Formula | C8H17N3OS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-(1-amino-1-sulfanylidenepentan-3-yl)-3-ethylurea |
| SMILES | CCNC(=O)NC(CC)CC(N)=S |
| InChI | InChI=1S/C8H17N3OS/c1-3-6(5-7(9)13)11-8(12)10-4-2/h6H,3-5H2,1-2H3,(H2,9,13)(H2,10,11,12) |
| InChIKey | KHBOXEHVAZMGDM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|