C9H14BrF2NO2 — CID 103516271
N-(5-bromo-4-oxopentan-2-yl)-N-ethyl-2,2-difluoroacetamide (PubChem CID 103516271) has the molecular formula C9H14BrF2NO2 and a molecular weight of 286.12 g/mol. Its IUPAC name is N-(5-bromo-4-oxopentan-2-yl)-N-ethyl-2,2-difluoroacetamide.
| Compound Name | N-(5-bromo-4-oxopentan-2-yl)-N-ethyl-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103516271 |
| Molecular Formula | C9H14BrF2NO2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | N-(5-bromo-4-oxopentan-2-yl)-N-ethyl-2,2-difluoroacetamide |
| SMILES | CCN(C(=O)C(F)F)C(C)CC(=O)CBr |
| InChI | InChI=1S/C9H14BrF2NO2/c1-3-13(9(15)8(11)12)6(2)4-7(14)5-10/h6,8H,3-5H2,1-2H3 |
| InChIKey | OHXPQYCJNCZMAP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|