C10H17F4NO3 — CID 157368354
N,N-diethylethanamine;(2,2-difluoroacetyl) 2,2-difluoroacetate (PubChem CID 157368354) has the molecular formula C10H17F4NO3 and a molecular weight of 275.24 g/mol. Its IUPAC name is N,N-diethylethanamine;(2,2-difluoroacetyl) 2,2-difluoroacetate.
| Compound Name | N,N-diethylethanamine;(2,2-difluoroacetyl) 2,2-difluoroacetate |
|---|---|
| PubChem CID | 157368354 |
| Molecular Formula | C10H17F4NO3 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N,N-diethylethanamine;(2,2-difluoroacetyl) 2,2-difluoroacetate |
| SMILES | CCN(CC)CC.O=C(OC(=O)C(F)F)C(F)F |
| InChI | InChI=1S/C6H15N.C4H2F4O3/c1-4-7(5-2)6-3;5-1(6)3(9)11-4(10)2(7)8/h4-6H2,1-3H3;1-2H |
| InChIKey | BJLMLQVLAXZEIQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|