C9H24N2 — CID 19095085
N,N-diethylethanamine;propan-2-amine (PubChem CID 19095085) has the molecular formula C9H24N2 and a molecular weight of 160.31 g/mol. Its IUPAC name is N,N-diethylethanamine;propan-2-amine.
| Compound Name | N,N-diethylethanamine;propan-2-amine |
|---|---|
| PubChem CID | 19095085 |
| Molecular Formula | C9H24N2 |
| Molecular Weight | 160.31 g/mol |
| Exact Mass | 160.19 |
| IUPAC Name | N,N-diethylethanamine;propan-2-amine |
| SMILES | CC(C)N.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C3H9N/c1-4-7(5-2)6-3;1-3(2)4/h4-6H2,1-3H3;3H,4H2,1-2H3 |
| InChIKey | CBQZEMCOEQGGFM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |