C7H20Cl2N2 — CID 137346902
(2R)-1-N,1-N-diethylpropane-1,2-diamine;dihydrochloride (PubChem CID 137346902) has the molecular formula C7H20Cl2N2 and a molecular weight of 203.16 g/mol. Its IUPAC name is (2R)-1-N,1-N-diethylpropane-1,2-diamine;dihydrochloride.
| Compound Name | (2R)-1-N,1-N-diethylpropane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 137346902 |
| Molecular Formula | C7H20Cl2N2 |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (2R)-1-N,1-N-diethylpropane-1,2-diamine;dihydrochloride |
| SMILES | CCN(CC)C[C@@H](C)N.Cl.Cl |
| InChI | InChI=1S/C7H18N2.2ClH/c1-4-9(5-2)6-7(3)8;;/h7H,4-6,8H2,1-3H3;2*1H/t7-;;/m1../s1 |
| InChIKey | KZYWGWPAKXMVPL-XCUBXKJBSA-N |
| XLogP | 1.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |