C9H24NP — CID 88654253
N,N-diethylethanamine;propan-2-ylphosphane (PubChem CID 88654253) has the molecular formula C9H24NP and a molecular weight of 177.27 g/mol. Its IUPAC name is N,N-diethylethanamine;propan-2-ylphosphane.
| Compound Name | N,N-diethylethanamine;propan-2-ylphosphane |
|---|---|
| PubChem CID | 88654253 |
| Molecular Formula | C9H24NP |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.16 |
| IUPAC Name | N,N-diethylethanamine;propan-2-ylphosphane |
| SMILES | CC(C)P.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C3H9P/c1-4-7(5-2)6-3;1-3(2)4/h4-6H2,1-3H3;3H,4H2,1-2H3 |
| InChIKey | MIXVBSYYXQLGEK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|