About ethane;propan-2-ylphosphane
ethane;propan-2-ylphosphane (PubChem CID 170611311) has the molecular formula C5H15P
and a molecular weight of 106.15 g/mol. Its IUPAC name is ethane;propan-2-ylphosphane.
Molecular Properties
| Compound Name | ethane;propan-2-ylphosphane |
| PubChem CID | 170611311 |
| Molecular Formula | C5H15P |
| Molecular Weight | 106.15 g/mol |
| Exact Mass | 106.09 |
| IUPAC Name | ethane;propan-2-ylphosphane |
| SMILES | CC.CC(C)P |
| InChI | InChI=1S/C3H9P.C2H6/c1-3(2)4;1-2/h3H,4H2,1-2H3;1-2H3 |
| InChIKey | KTDZHNJAZBOTIO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;propan-2-ylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-ylphosphane?
The IUPAC name of ethane;propan-2-ylphosphane (CID 170611311) is ethane;propan-2-ylphosphane.
What is the SMILES notation for ethane;propan-2-ylphosphane?
The canonical SMILES for ethane;propan-2-ylphosphane is CC.CC(C)P.
What is the InChIKey of ethane;propan-2-ylphosphane?
The InChIKey is KTDZHNJAZBOTIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9P.C2H6/c1-3(2)4;1-2/h3H,4H2,1-2H3;1-2H3.
What are the key properties of ethane;propan-2-ylphosphane?
ethane;propan-2-ylphosphane has a molecular weight of 106.15 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-ylphosphane is sourced from PubChem (CID 170611311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).