About butan-2-ylphosphane;hydrochloride
butan-2-ylphosphane;hydrochloride (PubChem CID 174764071) has the molecular formula C4H12ClP
and a molecular weight of 126.57 g/mol. Its IUPAC name is butan-2-ylphosphane;hydrochloride.
Molecular Properties
| Compound Name | butan-2-ylphosphane;hydrochloride |
| PubChem CID | 174764071 |
| Molecular Formula | C4H12ClP |
| Molecular Weight | 126.57 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | butan-2-ylphosphane;hydrochloride |
| SMILES | CCC(C)P.Cl |
| InChI | InChI=1S/C4H11P.ClH/c1-3-4(2)5;/h4H,3,5H2,1-2H3;1H |
| InChIKey | STSWYIWWVQEGNI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.57 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ylphosphane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylphosphane;hydrochloride?
The IUPAC name of butan-2-ylphosphane;hydrochloride (CID 174764071) is butan-2-ylphosphane;hydrochloride.
What is the SMILES notation for butan-2-ylphosphane;hydrochloride?
The canonical SMILES for butan-2-ylphosphane;hydrochloride is CCC(C)P.Cl.
What is the InChIKey of butan-2-ylphosphane;hydrochloride?
The InChIKey is STSWYIWWVQEGNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11P.ClH/c1-3-4(2)5;/h4H,3,5H2,1-2H3;1H.
What are the key properties of butan-2-ylphosphane;hydrochloride?
butan-2-ylphosphane;hydrochloride has a molecular weight of 126.57 g/mol, XLogP of 2.08, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylphosphane;hydrochloride is sourced from PubChem (CID 174764071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).