About pentan-2-ylphosphane
pentan-2-ylphosphane (PubChem CID 22981481) has the molecular formula C5H13P
and a molecular weight of 104.13 g/mol. Its IUPAC name is pentan-2-ylphosphane.
Molecular Properties
| Compound Name | pentan-2-ylphosphane |
| PubChem CID | 22981481 |
| Molecular Formula | C5H13P |
| Molecular Weight | 104.13 g/mol |
| Exact Mass | 104.08 |
| IUPAC Name | pentan-2-ylphosphane |
| SMILES | CCCC(C)P |
| InChI | InChI=1S/C5H13P/c1-3-4-5(2)6/h5H,3-4,6H2,1-2H3 |
| InChIKey | QJVNPOHYEQDGJB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.13 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-ylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-ylphosphane?
The IUPAC name of pentan-2-ylphosphane (CID 22981481) is pentan-2-ylphosphane.
What is the SMILES notation for pentan-2-ylphosphane?
The canonical SMILES for pentan-2-ylphosphane is CCCC(C)P.
What is the InChIKey of pentan-2-ylphosphane?
The InChIKey is QJVNPOHYEQDGJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13P/c1-3-4-5(2)6/h5H,3-4,6H2,1-2H3.
What are the key properties of pentan-2-ylphosphane?
pentan-2-ylphosphane has a molecular weight of 104.13 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-ylphosphane is sourced from PubChem (CID 22981481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).