About 2-methylhexan-3-ylphosphane;dihydrochloride
2-methylhexan-3-ylphosphane;dihydrochloride (PubChem CID 88799902) has the molecular formula C7H19Cl2P
and a molecular weight of 205.11 g/mol. Its IUPAC name is 2-methylhexan-3-ylphosphane;dihydrochloride.
Molecular Properties
| Compound Name | 2-methylhexan-3-ylphosphane;dihydrochloride |
| PubChem CID | 88799902 |
| Molecular Formula | C7H19Cl2P |
| Molecular Weight | 205.11 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-methylhexan-3-ylphosphane;dihydrochloride |
| SMILES | CCCC(P)C(C)C.Cl.Cl |
| InChI | InChI=1S/C7H17P.2ClH/c1-4-5-7(8)6(2)3;;/h6-7H,4-5,8H2,1-3H3;2*1H |
| InChIKey | OKSDRVOXFRZRNK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.11 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhexan-3-ylphosphane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexan-3-ylphosphane;dihydrochloride?
The IUPAC name of 2-methylhexan-3-ylphosphane;dihydrochloride (CID 88799902) is 2-methylhexan-3-ylphosphane;dihydrochloride.
What is the SMILES notation for 2-methylhexan-3-ylphosphane;dihydrochloride?
The canonical SMILES for 2-methylhexan-3-ylphosphane;dihydrochloride is CCCC(P)C(C)C.Cl.Cl.
What is the InChIKey of 2-methylhexan-3-ylphosphane;dihydrochloride?
The InChIKey is OKSDRVOXFRZRNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17P.2ClH/c1-4-5-7(8)6(2)3;;/h6-7H,4-5,8H2,1-3H3;2*1H.
What are the key properties of 2-methylhexan-3-ylphosphane;dihydrochloride?
2-methylhexan-3-ylphosphane;dihydrochloride has a molecular weight of 205.11 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexan-3-ylphosphane;dihydrochloride is sourced from PubChem (CID 88799902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).