About 1-chloropropylphosphane;hydrochloride
1-chloropropylphosphane;hydrochloride (PubChem CID 174764459) has the molecular formula C3H9Cl2P
and a molecular weight of 146.99 g/mol. Its IUPAC name is 1-chloropropylphosphane;hydrochloride.
Molecular Properties
| Compound Name | 1-chloropropylphosphane;hydrochloride |
| PubChem CID | 174764459 |
| Molecular Formula | C3H9Cl2P |
| Molecular Weight | 146.99 g/mol |
| Exact Mass | 145.98 |
| IUPAC Name | 1-chloropropylphosphane;hydrochloride |
| SMILES | CCC(P)Cl.Cl |
| InChI | InChI=1S/C3H8ClP.ClH/c1-2-3(4)5;/h3H,2,5H2,1H3;1H |
| InChIKey | VDHCWGMLVMUAMW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.99 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropropylphosphane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropropylphosphane;hydrochloride?
The IUPAC name of 1-chloropropylphosphane;hydrochloride (CID 174764459) is 1-chloropropylphosphane;hydrochloride.
What is the SMILES notation for 1-chloropropylphosphane;hydrochloride?
The canonical SMILES for 1-chloropropylphosphane;hydrochloride is CCC(P)Cl.Cl.
What is the InChIKey of 1-chloropropylphosphane;hydrochloride?
The InChIKey is VDHCWGMLVMUAMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8ClP.ClH/c1-2-3(4)5;/h3H,2,5H2,1H3;1H.
What are the key properties of 1-chloropropylphosphane;hydrochloride?
1-chloropropylphosphane;hydrochloride has a molecular weight of 146.99 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropropylphosphane;hydrochloride is sourced from PubChem (CID 174764459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).