C11H20Cl4 — CID 20749072
3,5,7,9-tetrachloroundecane (PubChem CID 20749072) has the molecular formula C11H20Cl4 and a molecular weight of 294.09 g/mol. Its IUPAC name is 3,5,7,9-tetrachloroundecane.
| Compound Name | 3,5,7,9-tetrachloroundecane |
|---|---|
| PubChem CID | 20749072 |
| Molecular Formula | C11H20Cl4 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 3,5,7,9-tetrachloroundecane |
| SMILES | CCC(Cl)CC(Cl)CC(Cl)CC(Cl)CC |
| InChI | InChI=1S/C11H20Cl4/c1-3-8(12)5-10(14)7-11(15)6-9(13)4-2/h8-11H,3-7H2,1-2H3 |
| InChIKey | XBRQCDSHJQKYKJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|