About 3-chloropentanenitrile
3-chloropentanenitrile (PubChem CID 23266229) has the molecular formula C5H8ClN
and a molecular weight of 117.58 g/mol. Its IUPAC name is 3-chloropentanenitrile.
Molecular Properties
| Compound Name | 3-chloropentanenitrile |
| PubChem CID | 23266229 |
| Molecular Formula | C5H8ClN |
| Molecular Weight | 117.58 g/mol |
| Exact Mass | 117.03 |
| IUPAC Name | 3-chloropentanenitrile |
| SMILES | CCC(Cl)CC#N |
| InChI | InChI=1S/C5H8ClN/c1-2-5(6)3-4-7/h5H,2-3H2,1H3 |
| InChIKey | FZLSIKURPMQSBJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.58 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropentanenitrile?
The IUPAC name of 3-chloropentanenitrile (CID 23266229) is 3-chloropentanenitrile.
What is the SMILES notation for 3-chloropentanenitrile?
The canonical SMILES for 3-chloropentanenitrile is CCC(Cl)CC#N.
What is the InChIKey of 3-chloropentanenitrile?
The InChIKey is FZLSIKURPMQSBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClN/c1-2-5(6)3-4-7/h5H,2-3H2,1H3.
What are the key properties of 3-chloropentanenitrile?
3-chloropentanenitrile has a molecular weight of 117.58 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropentanenitrile is sourced from PubChem (CID 23266229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).