About 3,3-dichloropropanenitrile
3,3-dichloropropanenitrile (PubChem CID 18537751) has the molecular formula C3H3Cl2N
and a molecular weight of 123.97 g/mol. Its IUPAC name is 3,3-dichloropropanenitrile.
Molecular Properties
| Compound Name | 3,3-dichloropropanenitrile |
| PubChem CID | 18537751 |
| Molecular Formula | C3H3Cl2N |
| Molecular Weight | 123.97 g/mol |
| Exact Mass | 122.96 |
| IUPAC Name | 3,3-dichloropropanenitrile |
| SMILES | N#CCC(Cl)Cl |
| InChI | InChI=1S/C3H3Cl2N/c4-3(5)1-2-6/h3H,1H2 |
| InChIKey | YISPXONEJASRSG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.97 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dichloropropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dichloropropanenitrile?
The IUPAC name of 3,3-dichloropropanenitrile (CID 18537751) is 3,3-dichloropropanenitrile.
What is the SMILES notation for 3,3-dichloropropanenitrile?
The canonical SMILES for 3,3-dichloropropanenitrile is N#CCC(Cl)Cl.
What is the InChIKey of 3,3-dichloropropanenitrile?
The InChIKey is YISPXONEJASRSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3Cl2N/c4-3(5)1-2-6/h3H,1H2.
What are the key properties of 3,3-dichloropropanenitrile?
3,3-dichloropropanenitrile has a molecular weight of 123.97 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dichloropropanenitrile is sourced from PubChem (CID 18537751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).