About 1-cyanobutan-2-ylazanium
1-cyanobutan-2-ylazanium (PubChem CID 59058535) has the molecular formula C5H11N2+
and a molecular weight of 99.16 g/mol. Its IUPAC name is 1-cyanobutan-2-ylazanium.
Molecular Properties
| Compound Name | 1-cyanobutan-2-ylazanium |
| PubChem CID | 59058535 |
| Molecular Formula | C5H11N2+ |
| Molecular Weight | 99.16 g/mol |
| Exact Mass | 99.09 |
| IUPAC Name | 1-cyanobutan-2-ylazanium |
| SMILES | CCC([NH3+])CC#N |
| InChI | InChI=1S/C5H10N2/c1-2-5(7)3-4-6/h5H,2-3,7H2,1H3/p+1 |
| InChIKey | FVPPLRDSFQDFLX-UHFFFAOYSA-O |
| XLogP | -0.08 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.16 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyanobutan-2-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanobutan-2-ylazanium?
The IUPAC name of 1-cyanobutan-2-ylazanium (CID 59058535) is 1-cyanobutan-2-ylazanium.
What is the SMILES notation for 1-cyanobutan-2-ylazanium?
The canonical SMILES for 1-cyanobutan-2-ylazanium is CCC([NH3+])CC#N.
What is the InChIKey of 1-cyanobutan-2-ylazanium?
The InChIKey is FVPPLRDSFQDFLX-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H10N2/c1-2-5(7)3-4-6/h5H,2-3,7H2,1H3/p+1.
What are the key properties of 1-cyanobutan-2-ylazanium?
1-cyanobutan-2-ylazanium has a molecular weight of 99.16 g/mol, XLogP of -0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanobutan-2-ylazanium is sourced from PubChem (CID 59058535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).