About 5-aminohexanenitrile
5-aminohexanenitrile (PubChem CID 29023) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 5-aminohexanenitrile.
Molecular Properties
| Compound Name | 5-aminohexanenitrile |
| PubChem CID | 29023 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 5-aminohexanenitrile |
| SMILES | CC(N)CCCC#N |
| InChI | InChI=1S/C6H12N2/c1-6(8)4-2-3-5-7/h6H,2-4,8H2,1H3 |
| InChIKey | HTXLVBCGHGHRHL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-aminohexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminohexanenitrile?
The IUPAC name of 5-aminohexanenitrile (CID 29023) is 5-aminohexanenitrile.
What is the SMILES notation for 5-aminohexanenitrile?
The canonical SMILES for 5-aminohexanenitrile is CC(N)CCCC#N.
What is the InChIKey of 5-aminohexanenitrile?
The InChIKey is HTXLVBCGHGHRHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-6(8)4-2-3-5-7/h6H,2-4,8H2,1H3.
What are the key properties of 5-aminohexanenitrile?
5-aminohexanenitrile has a molecular weight of 112.18 g/mol, XLogP of 1.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminohexanenitrile is sourced from PubChem (CID 29023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).