C6H11NO2 — CID 175092381
3,4-dihydroxyhexanenitrile (PubChem CID 175092381) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is 3,4-dihydroxyhexanenitrile.
| Compound Name | 3,4-dihydroxyhexanenitrile |
|---|---|
| PubChem CID | 175092381 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 3,4-dihydroxyhexanenitrile |
| SMILES | CCC(O)C(O)CC#N |
| InChI | InChI=1S/C6H11NO2/c1-2-5(8)6(9)3-4-7/h5-6,8-9H,2-3H2,1H3 |
| InChIKey | NFMIZWAHJQDQBH-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |