About 2-butoxy-4-chlorohexane
2-butoxy-4-chlorohexane (PubChem CID 165359330) has the molecular formula C10H21ClO
and a molecular weight of 192.73 g/mol. Its IUPAC name is 2-butoxy-4-chlorohexane.
Molecular Properties
| Compound Name | 2-butoxy-4-chlorohexane |
| PubChem CID | 165359330 |
| Molecular Formula | C10H21ClO |
| Molecular Weight | 192.73 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-butoxy-4-chlorohexane |
| SMILES | CCCCOC(C)CC(Cl)CC |
| InChI | InChI=1S/C10H21ClO/c1-4-6-7-12-9(3)8-10(11)5-2/h9-10H,4-8H2,1-3H3 |
| InChIKey | AFRVZEAQINBIBI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-4-chlorohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-4-chlorohexane?
The IUPAC name of 2-butoxy-4-chlorohexane (CID 165359330) is 2-butoxy-4-chlorohexane.
What is the SMILES notation for 2-butoxy-4-chlorohexane?
The canonical SMILES for 2-butoxy-4-chlorohexane is CCCCOC(C)CC(Cl)CC.
What is the InChIKey of 2-butoxy-4-chlorohexane?
The InChIKey is AFRVZEAQINBIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21ClO/c1-4-6-7-12-9(3)8-10(11)5-2/h9-10H,4-8H2,1-3H3.
What are the key properties of 2-butoxy-4-chlorohexane?
2-butoxy-4-chlorohexane has a molecular weight of 192.73 g/mol, XLogP of 3.60, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-4-chlorohexane is sourced from PubChem (CID 165359330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).