C11H19Cl5 — CID 20749064
1,3,5,7-tetrachloro-4-(2-chloroethyl)nonane (PubChem CID 20749064) has the molecular formula C11H19Cl5 and a molecular weight of 328.54 g/mol. Its IUPAC name is 1,3,5,7-tetrachloro-4-(2-chloroethyl)nonane.
| Compound Name | 1,3,5,7-tetrachloro-4-(2-chloroethyl)nonane |
|---|---|
| PubChem CID | 20749064 |
| Molecular Formula | C11H19Cl5 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 1,3,5,7-tetrachloro-4-(2-chloroethyl)nonane |
| SMILES | CCC(Cl)CC(Cl)C(CCCl)C(Cl)CCCl |
| InChI | InChI=1S/C11H19Cl5/c1-2-8(14)7-11(16)9(3-5-12)10(15)4-6-13/h8-11H,2-7H2,1H3 |
| InChIKey | WEVDSMSRZZNUQJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|