C10H20Cl2 — CID 155032918
(4S)-1,4-dichloro-3,6-dimethyloctane (PubChem CID 155032918) has the molecular formula C10H20Cl2 and a molecular weight of 211.18 g/mol. Its IUPAC name is (4S)-1,4-dichloro-3,6-dimethyloctane.
| Compound Name | (4S)-1,4-dichloro-3,6-dimethyloctane |
|---|---|
| PubChem CID | 155032918 |
| Molecular Formula | C10H20Cl2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (4S)-1,4-dichloro-3,6-dimethyloctane |
| SMILES | CCC(C)C[C@H](Cl)C(C)CCCl |
| InChI | InChI=1S/C10H20Cl2/c1-4-8(2)7-10(12)9(3)5-6-11/h8-10H,4-7H2,1-3H3/t8?,9?,10-/m0/s1 |
| InChIKey | UVALLBZOMHATTA-RTBKNWGFSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|