C8H15Cl3 — CID 20749063
1,2,5-trichlorooctane (PubChem CID 20749063) has the molecular formula C8H15Cl3 and a molecular weight of 217.57 g/mol. Its IUPAC name is 1,2,5-trichlorooctane.
| Compound Name | 1,2,5-trichlorooctane |
|---|---|
| PubChem CID | 20749063 |
| Molecular Formula | C8H15Cl3 |
| Molecular Weight | 217.57 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 1,2,5-trichlorooctane |
| SMILES | CCCC(Cl)CCC(Cl)CCl |
| InChI | InChI=1S/C8H15Cl3/c1-2-3-7(10)4-5-8(11)6-9/h7-8H,2-6H2,1H3 |
| InChIKey | AREOFHKOAGCWGJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|