C3H7Cl3O — CID 172556253
1,2,3-trichloropropane;hydrate (PubChem CID 172556253) has the molecular formula C3H7Cl3O and a molecular weight of 165.45 g/mol. Its IUPAC name is 1,2,3-trichloropropane;hydrate.
| Compound Name | 1,2,3-trichloropropane;hydrate |
|---|---|
| PubChem CID | 172556253 |
| Molecular Formula | C3H7Cl3O |
| Molecular Weight | 165.45 g/mol |
| Exact Mass | 163.96 |
| IUPAC Name | 1,2,3-trichloropropane;hydrate |
| SMILES | ClCC(Cl)CCl.O |
| InChI | InChI=1S/C3H5Cl3.H2O/c4-1-3(6)2-5;/h3H,1-2H2;1H2 |
| InChIKey | VURINPISULLCBU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|