C3H5Cl3 — CID 7285
1,2,3-trichloropropane (PubChem CID 7285) has the molecular formula C3H5Cl3 and a molecular weight of 147.43 g/mol. Its IUPAC name is 1,2,3-trichloropropane.
| Compound Name | 1,2,3-trichloropropane |
|---|---|
| PubChem CID | 7285 |
| Molecular Formula | C3H5Cl3 |
| Molecular Weight | 147.43 g/mol |
| Exact Mass | 145.95 |
| IUPAC Name | 1,2,3-trichloropropane |
| SMILES | ClCC(Cl)CCl |
| InChI | InChI=1S/C3H5Cl3/c4-1-3(6)2-5/h3H,1-2H2 |
| InChIKey | CFXQEHVMCRXUSD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|