About 2,5-dichlorooctane
2,5-dichlorooctane (PubChem CID 56987607) has the molecular formula C8H16Cl2
and a molecular weight of 183.12 g/mol. Its IUPAC name is 2,5-dichlorooctane.
Molecular Properties
| Compound Name | 2,5-dichlorooctane |
| PubChem CID | 56987607 |
| Molecular Formula | C8H16Cl2 |
| Molecular Weight | 183.12 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2,5-dichlorooctane |
| SMILES | CCCC(Cl)CCC(C)Cl |
| InChI | InChI=1S/C8H16Cl2/c1-3-4-8(10)6-5-7(2)9/h7-8H,3-6H2,1-2H3 |
| InChIKey | FSQFBQMXXDUBSM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.12 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dichlorooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichlorooctane?
The IUPAC name of 2,5-dichlorooctane (CID 56987607) is 2,5-dichlorooctane.
What is the SMILES notation for 2,5-dichlorooctane?
The canonical SMILES for 2,5-dichlorooctane is CCCC(Cl)CCC(C)Cl.
What is the InChIKey of 2,5-dichlorooctane?
The InChIKey is FSQFBQMXXDUBSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16Cl2/c1-3-4-8(10)6-5-7(2)9/h7-8H,3-6H2,1-2H3.
What are the key properties of 2,5-dichlorooctane?
2,5-dichlorooctane has a molecular weight of 183.12 g/mol, XLogP of 3.80, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichlorooctane is sourced from PubChem (CID 56987607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).