C10H18Cl4 — CID 146677823
2,3,6,9-tetrachlorodecane (PubChem CID 146677823) has the molecular formula C10H18Cl4 and a molecular weight of 280.07 g/mol. Its IUPAC name is 2,3,6,9-tetrachlorodecane.
| Compound Name | 2,3,6,9-tetrachlorodecane |
|---|---|
| PubChem CID | 146677823 |
| Molecular Formula | C10H18Cl4 |
| Molecular Weight | 280.07 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 2,3,6,9-tetrachlorodecane |
| SMILES | CC(Cl)CCC(Cl)CCC(Cl)C(C)Cl |
| InChI | InChI=1S/C10H18Cl4/c1-7(11)3-4-9(13)5-6-10(14)8(2)12/h7-10H,3-6H2,1-2H3 |
| InChIKey | HYJQVXHUENYDAK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.07 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|